White Powder Trans-Cinnamic Acid Manufacturer
Specification of thisWhite Powder Trans-Cinnamic Acid Manufacturers
flavors and fragrances, Organic synthesis
Parameters of thisChina White Powder Trans-Cinnamic Acid
|
product Name |
trans-Cinnamic acid |
|
Synonyms |
trans-3-Phenylacrylic acid; trans-3-Phenyl-2-propenoic acid; trans-Cinnamic acid; (2E)-3-phenylprop-2-enoic acid; Cinnamic acid; 3-Phenylacrylic acid; Phenylacrylic acid; 3-phenylprop-2-enoic acid; 2-{[(3alpha,5beta,6beta,7beta,8xi,9xi,14xi)-3,6,7-trihydroxy-24-oxocholan-24-yl]amino}ethanesulfonic acid; (2E)-3-phenylprop-2-enoate; (2Z)-3-phenylprop-2-enoic acid; β-phenylacrylic acid; (E)-Cinnamic acid |
|
Molecular Formula |
C9H8O2 |
|
Molecular Weight |
148.1586 |
|
InChI |
InChI=1/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6- |
|
CAS Registry Number |
140-10-3;621-82-9 |
|
EINECS |
205-398-1;210-708-3 |
|
Molecular Structure |
 |
|
Density |
1.185g/cm3 |
|
Melting point |
131-136℃ |
|
Boiling point |
264.999°C at 760 mmHg |
|
Refractive index |
1.616 |
|
Flash point |
189.53°C |
|
Water solubility |
0.4 g/L (20℃) |
|
Vapour Pressur |
0.005mmHg at 25°C |
Looking forward to your inquiry for this White Powder Trans-Cinnamic Acid Suppliers
